| Name |
Syringetin 3-O-rutinoside Syringetin 3-rutinoside |
| Formula |
C29H34O17 |
| Mw |
654.17959966 |
| CAS RN |
53430-50-5 |
| C_ID |
C00005780
, 
|
| InChIKey |
BWDMLCWSGGUHGK-JTYKZUITNA-N |
| InChICode |
InChI=1S/C29H34O17/c1-9-18(32)22(36)24(38)28(43-9)42-8-16-20(34)23(37)25(39)29(45-16)46-27-21(35)17-12(31)6-11(30)7-13(17)44-26(27)10-4-14(40-2)19(33)15(5-10)41-3/h4-7,9,16,18,20,22-25,28-34,36-39H,8H2,1-3H3/t9-,16+,18-,20-,22-,23+,24-,25+,28+,29-/m0/s1 |
| SMILES |
COc1cc(-c2oc3cc(O)cc(O)c3c(=O)c2O[C@@H]2OC(CO[C@@H]3OC(C)[C@H](O)[C@H](O)C3O)[C@@H](O)C(O)C2O)cc(OC)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Lathyrus aphaca  | Ref. |
| Plantae | Limnanthaceae | Limnanthes douglasii | Ref. |
| Plantae | Pinaceae | Abies amabilis | Ref. |
| Plantae | Pinaceae | Larix decidua  | Ref. |
| Plantae | Pinaceae | Larix sibirica | Ref. |
| Plantae | Pinaceae | Picea abies  | Ref. |
| Plantae | Zygophyllaceae | Larrea spp. | Ref. |
|
|
zoom in
| Organism | Larix sibirica | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Tyukavkina,Khim.Prir.Soedin,10,(1974),157
Markham,Phytochem.,37,(1994),163 |
|---|
|