| Name |
Myricetin 3'-glucoside |
| Formula |
C21H20O13 |
| Mw |
480.09039073 |
| CAS RN |
520-14-9 |
| C_ID |
C00005734
, 
|
| InChIKey |
ZJYAVUPWMNHHEU-KSZJOVGZNA-N |
| InChICode |
InChI=1S/C21H20O13/c22-5-12-15(27)17(29)19(31)21(34-12)33-11-2-6(1-9(25)14(11)26)20-18(30)16(28)13-8(24)3-7(23)4-10(13)32-20/h1-4,12,15,17,19,21-27,29-31H,5H2/t12-,15-,17-,19-,21-/m1/s1 |
| SMILES |
O=c1c(O)c(-c2cc(O)c(O)c(O[C@@H]3OC(CO)[C@@H](O)C(O)C3O)c2)oc2cc(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cannabaceae | Cannabis sativa var. indica  | Ref. |
| Plantae | Fabaceae | Astragalus complanatus  | Ref. |
| Plantae | Grossulariaceae | Ribes nigrum  | Ref. |
| Plantae | Malvaceae | Hibiscus abelmoschus  | Ref. |
| Plantae | Myrtaceae | Myrtus communis  | Ref. |
| Plantae | Theaceae | Thea sinensis  | Ref. |
|
|
zoom in
| Organism | Myrtus communis | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Rao,Proc.Indian.Acad.Sci,Sect.A.,14,(1941),265 |
|---|
|