| Name |
Myricetin 3-glucuronide Myricetin 3-O-beta-D-glucuronide |
| Formula |
C21H18O14 |
| Mw |
494.06965529 |
| CAS RN |
77363-65-6 |
| C_ID |
C00005731
, 
|
| InChIKey |
MBWOCQLTCWTIJE-NTEJZTTHNA-N |
| InChICode |
InChI=1S/C21H18O14/c22-6-3-7(23)11-10(4-6)33-17(5-1-8(24)12(26)9(25)2-5)18(13(11)27)34-21-16(30)14(28)15(29)19(35-21)20(31)32/h1-4,14-16,19,21-26,28-30H,(H,31,32)/t14-,15+,16-,19+,21-/m1/s1 |
| SMILES |
O=C(O)[C@H]1O[C@@H](Oc2c(-c3cc(O)c(O)c(O)c3)oc3cc(O)cc(O)c3c2=O)C(O)C(O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Betulaceae | Betula pendula  | Ref. |
| Plantae | Betulaceae | Betula pubescens  | Ref. |
| Plantae | Ericaceae | Richea angustifolia | Ref. |
| Plantae | Ericaceae | Richea scoparia | Ref. |
| Plantae | Lythraceae | Diplusodon helianthemifolius | Ref. |
| Plantae | Myrtaceae | Eucalyptus occidentalis | Ref. |
| Plantae | Myrtaceae | Eugenia jambolana  | Ref. |
| Plantae | Onagraceae | Oenothera cheiranthifolia | Ref. |
| Plantae | Polemoniaceae | Linanthus spp. | Ref. |
| Plantae | Polygonaceae | Eriogonum nudum | Ref. |
| Plantae | Rosaceae | Potentilla anserina  | Ref. |
| Plantae | Vitaceae | Vitis spp.  | Ref. |
|
|
zoom in
| Organism | Diplusodon helianthemifolius | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Abd-Alla,Phytochem.,19,(1980),2629
Smith,Biochem.Syst.Ecol.,10,(1982),37 |
|---|
|