| Name |
Quercetin-3-O-rhamnoside-7-O-glucoside Quercetin 3-rhamnoside-7-glucoside |
| Formula |
C27H30O16 |
| Mw |
610.15338491 |
| CAS RN |
17306-45-5 |
| C_ID |
C00005431
, 
|
| InChIKey |
MCTZMXCUYPDYNE-ITIRTPILNA-N |
| InChICode |
InChI=1S/C27H30O16/c1-8-17(32)20(35)22(37)26(39-8)43-25-19(34)16-13(31)5-10(40-27-23(38)21(36)18(33)15(7-28)42-27)6-14(16)41-24(25)9-2-3-11(29)12(30)4-9/h2-6,8,15,17-18,20-23,26-33,35-38H,7H2,1H3/t8-,15+,17-,18+,20+,21-,22-,23+,26-,27+/m0/s1 |
| SMILES |
CC1O[C@@H](Oc2c(-c3ccc(O)c(O)c3)oc3cc(O[C@@H]4OC(CO)[C@@H](O)[C@H](O)C4O)cc(O)c3c2=O)[C@@H](O)C(O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Actinidiaceae | Actinidia deliciosa  | Ref. |
| Plantae | Celastraceae | Celastrus hypoglaucus | Ref. |
| Plantae | Celastraceae | Euonymus europaea  | Ref. |
| Plantae | Celastraceae | Euonymus maackii | Ref. |
| Plantae | Crassulaceae | Sedum alfredi | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum vacciniifolium | Ref. |
| Plantae | Fabaceae | Lotus corniculatus  | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Saxifragaceae | Lithophragma bolanderi | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
|
|
zoom in
| Organism | Sedum alfredi | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Nogradi,Chem.Ber.,104,(1971),3618
Reynaud,Phytochem.,21,(1982),2604 |
|---|
|