| Name |
Quercetin 5-glucoside Quercetin 5-O-beta-D-glucopyranoside |
| Formula |
C21H20O12 |
| Mw |
464.09547611 |
| CAS RN |
34199-21-8 |
| C_ID |
C00005379
, 
|
| InChIKey |
QJTYCCFDQWFJHU-YHAOOQQVNA-N |
| InChICode |
InChI=1S/C21H20O12/c22-6-13-15(26)17(28)19(30)21(33-13)32-12-5-8(23)4-11-14(12)16(27)18(29)20(31-11)7-1-2-9(24)10(25)3-7/h1-5,13,15,17,19,21-26,28-30H,6H2/t13-,15+,17-,19+,21+/m0/s1 |
| SMILES |
O=c1c(O)c(-c2ccc(O)c(O)c2)oc2cc(O)cc(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Bombycidae | Bombyx mori  | Ref. |
| Plantae | Asteraceae | Anacyclus pyrethrum | Ref. |
| Plantae | Asteraceae | Artemisia monosperma | Ref. |
| Plantae | Asteraceae | Cotula australis | Ref. |
| Plantae | Asteraceae | Cotula barbata | Ref. |
| Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
| Plantae | Asteraceae | Scolymus hispanicus  | Ref. |
| Plantae | Polemoniaceae | Linanthus spp. | Ref. |
| Plantae | Saxifragaceae | Saxifraga stolonifera  | Ref. |
|
|
zoom in
| Organism | Cotula barbata | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Farkas,Chem.Ber.,105,(1972),3505
Morita,Chem.Pharm.Bull.,22,(1974),1487 |
|---|
|