| Name |
Kaempferol 3-robinobioside-7-glucoside |
| Formula |
C33H40O20 |
| Mw |
756.21129372 |
| CAS RN |
114924-89-9,142631-38-7 |
| C_ID |
C00005225
, 
|
| InChIKey |
SCEPATPTKMFDSR-YNAPDMGQNA-N |
| InChICode |
InChI=1S/C33H40O20/c1-10-19(37)23(41)26(44)31(48-10)47-9-17-21(39)25(43)28(46)33(52-17)53-30-22(40)18-14(36)6-13(49-32-27(45)24(42)20(38)16(8-34)51-32)7-15(18)50-29(30)11-2-4-12(35)5-3-11/h2-7,10,16-17,19-21,23-28,31-39,41-46H,8-9H2,1H3/t10-,16+,17-,19-,20+,21-,23-,24-,25+,26+,27+,28+,31+,32+,33-/m0/s1 |
| SMILES |
CC1O[C@@H](OCC2O[C@@H](Oc3c(-c4ccc(O)cc4)oc4cc(O[C@@H]5OC(CO)[C@@H](O)[C@H](O)C5O)cc(O)c4c3=O)C(O)C(O)[C@H]2O)C(O)[C@@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Vinca major  | Ref. |
| Plantae | Fabaceae | Vigna aconitifolia | Ref. |
| Plantae | Longaniaceae | Strychnos variabilis | Ref. |
| Plantae | Solanaceae | Atropa belladonna | Ref. |
| Plantae | Solanaceae | Nicotiana spp. | Ref. |
| Plantae | Solanaceae | Physalis peruviana | Ref. |
|
|
zoom in
| Organism | Nicotiana spp. |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Sonanini,Pharm.Acta Helv.,41,(1966),670
Brasseur,Phytochem.,27,(1988),1487 |
|---|
|
