| Name |
Kaempferol 3-vicianoside |
| Formula |
C26H28O15 |
| Mw |
580.14282023 |
| CAS RN |
110352-79-9 |
| C_ID |
C00005162
, 
|
| InChIKey |
YJPZWZRYHLEDNA-WVUQAUGGNA-N |
| InChICode |
InChI=1S/C26H28O15/c27-10-3-1-9(2-4-10)23-24(19(33)16-12(29)5-11(28)6-14(16)39-23)41-26-22(36)20(34)18(32)15(40-26)8-38-25-21(35)17(31)13(30)7-37-25/h1-6,13,15,17-18,20-22,25-32,34-36H,7-8H2/t13-,15-,17+,18-,20+,21+,22-,25+,26+/m1/s1 |
| SMILES |
O=c1c(O[C@@H]2OC(CO[C@@H]3OC[C@H](O)[C@H](O)C3O)[C@@H](O)C(O)C2O)c(-c2ccc(O)cc2)oc2cc(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Aspleniaceae | Asplenium nidus  | Ref. |
| Plantae | Asteraceae | Coreopsis spp. | Ref. |
| Plantae | Asteraceae | Parthenium hysterophorus  | Ref. |
| Plantae | Asteraceae | Wyethia helenioides | Ref. |
| Plantae | Menyanthaceae | Nymphoides spp. | Ref. |
| Plantae | Saxifragaceae | Mitella breweri | Ref. |
| Plantae | Thelypteridaceae | Phegopteris polypodioides | Ref. |
|
|
zoom in
| Organism | Nymphoides spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Rodriguez,Biochem.Syst.Ecol.,5,(1977),207
Imperato,Chem.Ind.(London),(1987),487 |
|---|
|