| Name |
Juglanin Kaempferol 3-O-arabinoside (-)-Kaempferol 3-O-arabinoside Kaempferol 3-O-alpha-L-arabinofuranoside |
| Formula |
C20H18O10 |
| Mw |
418.0899968 |
| CAS RN |
5041-67-8 |
| C_ID |
C00005132
, 
|
| InChIKey |
POQICXMTUPVZMX-CSYAPIQTNA-N |
| InChICode |
InChI=1S/C20H18O10/c21-7-13-15(25)17(27)20(29-13)30-19-16(26)14-11(24)5-10(23)6-12(14)28-18(19)8-1-3-9(22)4-2-8/h1-6,13,15,17,20-25,27H,7H2/t13-,15-,17+,20-/m1/s1 |
| SMILES |
O=c1c(O[C@@H]2O[C@@H](CO)C(O)C2O)c(-c2ccc(O)cc2)oc2cc(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Guatteria rupestris | Ref. |
| Plantae | Annonaceae | Guatteria villosissima | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Aspleniaceae | Asplenium trichomanes-ramosum | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum rimosum | Ref. |
| Plantae | Euphorbiaceae | Speranskia tuberculata | Ref. |
| Plantae | Juglandaceae | Juglans regia  | Ref. |
| Plantae | Malvaceae | Corchorus olitorius  | Ref. |
| Plantae | Polygonaceae | Polygonum aviculare  | Ref. |
| Plantae | Rosaceae | Prunus spinosa  | Ref. |
| Plantae | Rosaceae | Rosa spp. | Ref. |
| Plantae | Rosaceae | Sorbaria sorbifolia  | Ref. |
| Plantae | Sapindaceae | Aesculus hippocastanum  | Ref. |
| Plantae | Saxifragaceae | Rodgersia podophylla  | Ref. |
| - | - | Tapirira guianensis  | Ref. |
|
|
zoom in
| Organism | Erythroxylum rimosum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|