| Name |
Isolicoflavonol 3,5,7-Trihydroxy-2-[4-hydroxy-3-(3-methyl-2-butenyl)phenyl]-4H-1-benzopyran-4-one |
| Formula |
C20H18O6 |
| Mw |
354.11033831 |
| CAS RN |
94805-83-1 |
| C_ID |
C00005010
, 
|
| InChIKey |
PGCKDCPTJAQQSQ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C20H18O6/c1-10(2)3-4-11-7-12(5-6-14(11)22)20-19(25)18(24)17-15(23)8-13(21)9-16(17)26-20/h3,5-9,21-23,25H,4H2,1-2H3 |
| SMILES |
CC(C)=CCc1cc(-c2oc3cc(O)cc(O)c3c(=O)c2O)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Euphorbiaceae | Macaranga conifera | Ref. |
| Plantae | Fabaceae | Glycyrrhiza aspera | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza inflata  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
| Plantae | Moraceae | Broussonetia papyrifera  | Ref. |
| Plantae | Platanaceae | Platanus acerifolia | Ref. |
|
|
zoom in
| Organism | Glycyrrhiza uralensis | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Zhu,Yaoxue Xuebao,42,(1984),1080
Hatano,Chem.Pharm.Bull.,36,(1988),2090 |
|---|
|