| Name |
Noricaritin hexoside Noricaritin |
| Formula |
C20H20O7 |
| Mw |
372.12090299 |
| CAS RN |
5240-95-9 |
| C_ID |
C00005001
, 
|
| InChIKey |
CTGVBHDTGZUEJZ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C20H20O7/c1-20(2,26)8-7-12-13(22)9-14(23)15-16(24)17(25)18(27-19(12)15)10-3-5-11(21)6-4-10/h3-6,9,21-23,25-26H,7-8H2,1-2H3 |
| SMILES |
CC(C)(O)CCc1c(O)cc(O)c2c(=O)c(O)c(-c3ccc(O)cc3)oc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Berberidaceae | Epimedium cremeum | Ref. |
| Plantae | Berberidaceae | Epimedium mecranthum | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Rutaceae | Phellodendron amurense  | Ref. |
| Plantae | Rutaceae | Phellodendron sachalinense | Ref. |
|
|
zoom in
| Organism | Phellodendron sachalinense | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Hasegawa,J.Am.Chem.Soc.,75,(1953),5507 |
|---|
|