| Name |
3,3',4',5,6,7,8-Heptamethoxyflavone 3,5,6,7,8,3',4'-Heptamethoxyflavone 2-(3,4-Dimethoxyphenyl)-3,5,6,7,8-pentamethoxy-4H-1-benzopyran-4-one |
| Formula |
C22H24O9 |
| Mw |
432.14203237 |
| CAS RN |
1178-24-1 |
| C_ID |
C00004804
, 
|
| InChIKey |
SSXJHQZOHUYEGD-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C22H24O9/c1-24-12-9-8-11(10-13(12)25-2)16-19(27-4)15(23)14-17(26-3)20(28-5)22(30-7)21(29-6)18(14)31-16/h8-10H,1-7H3 |
| SMILES |
COc1ccc(-c2oc3c(OC)c(OC)c(OC)c(OC)c3c(=O)c2OC)cc1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Lauraceae | Laurus nobilis L.  | Ref. |
| Plantae | Rutaceae | Citrus hassaku  | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Rutaceae | Citrus madurensis | Ref. |
| Plantae | Rutaceae | Citrus paradisi  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Rutaceae | Citrus spp. | Ref. |
|
|
zoom in
| Organism | Citrus paradisi | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Swift,J.Agric.Food Chem.,13,(1965),431
Walther,Planta Med.,14,(1966),453 |
|---|
|