| Name |
Combretol 5-Hydroxy-3,3',4',5',7-pentamethoxyflavone 5-Hydroxy-3,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)-4H-1-benzopyran-4-one |
| Formula |
C20H20O8 |
| Mw |
388.11581762 |
| CAS RN |
5084-19-5 |
| C_ID |
C00004777
, 
|
| InChIKey |
SUNUQCQIFHHEOW-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C20H20O8/c1-23-11-8-12(21)16-13(9-11)28-18(20(27-5)17(16)22)10-6-14(24-2)19(26-4)15(7-10)25-3/h6-9,21H,1-5H3 |
| SMILES |
COc1cc(O)c2c(=O)c(OC)c(-c3cc(OC)c(OC)c(OC)c3)oc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Xanthocephalum gymnospermoides | Ref. |
| Plantae | Betulaceae | Betula nigra  | Ref. |
| Plantae | Combretaceae | Combretum quadrangulare  | Ref. |
| Plantae | Crassulaceae | Aeonium spp. | Ref. |
| Plantae | Pteridaceae | Notholaena candida | Ref. |
| Plantae | Pteridaceae | Notholaena schaffneri | Ref. |
| Plantae | Rhizophoraceae | Cassipourea madagascariensis | Ref. |
| Plantae | Rutaceae | Bosistoa floydii | Ref. |
| Plantae | Solanaceae | Iochroma warscewiczii | Ref. |
|
|
zoom in
| Organism | Notholaena candida | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Mongkolsuk,J.Chem.Soc.C,(1966),125
Sim,J.Chem.Soc.C,(1967),976 |
|---|
|