| Name |
Mearnsetin |
| Formula |
C16H12O8 |
| Mw |
332.05321736 |
| CAS RN |
16805-10-0 |
| C_ID |
C00004762
, 
|
| InChIKey |
HKEQVXVLTOSXLQ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O8/c1-23-16-9(19)2-6(3-10(16)20)15-14(22)13(21)12-8(18)4-7(17)5-11(12)24-15/h2-5,17-20,22H,1H3 |
| SMILES |
COc1c(O)cc(-c2oc3cc(O)cc(O)c3c(=O)c2O)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Landolphia kirkii  | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Celastraceae | Maytenus loevis | Ref. |
| Plantae | Didiereaceae | Alluaudia ascendens | Ref. |
| Plantae | Fabaceae | Acacia mearnsii  | Ref. |
| Plantae | Fabaceae | Flemingia stricta  | Ref. |
| Plantae | Labiatae | Vitex negundo  | Ref. |
| Plantae | Rhamnaceae | Rhamnus pallasii | Ref. |
|
|
zoom in
| Organism | Acacia mearnsii | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
MacKenzie,Phytochem.,8,(1969),1813 |
|---|
|