| Name |
Gossypetin hexamethyl ether 3,5,7,8,3',4'-Hexamethoxyflavone 2-(3,4-Dimethoxyphenyl)-3,5,7,8-tetramethoxy-4H-1-benzopyran-4-one |
| Formula |
C21H22O8 |
| Mw |
402.13146768 |
| CAS RN |
7741-47-1 |
| C_ID |
C00004745
, 
|
| InChIKey |
XBZIUXVIWRAJKB-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C21H22O8/c1-23-12-8-7-11(9-13(12)24-2)18-21(28-6)17(22)16-14(25-3)10-15(26-4)19(27-5)20(16)29-18/h7-10H,1-6H3 |
| SMILES |
COc1ccc(-c2oc3c(OC)c(OC)cc(OC)c3c(=O)c2OC)cc1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cruciferae | Capsella bursa-pastoris  | Ref. |
| Plantae | Rutaceae | Citrus hassaku  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Rutaceae | Melicope triphylla | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
|
|
zoom in
| Organism | Melicope triphylla | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Tatum,Phytochem.,11,(1972),2283 |
|---|
|