| Name |
Tamarixetin |
| Formula |
C16H12O7 |
| Mw |
316.05830274 |
| CAS RN |
603-61-2 |
| C_ID |
C00004636
, 
|
| InChIKey |
FPLMIPQZHHQWHN-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O7/c1-22-11-3-2-7(4-9(11)18)16-15(21)14(20)13-10(19)5-8(17)6-12(13)23-16/h2-6,17-19,21H,1H3 |
| SMILES |
COc1ccc(-c2oc3cc(O)cc(O)c3c(=O)c2O)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Alliaceae | Allium cepa  | Ref. |
| Plantae | Apiaceae | Anethum graveolens  | Ref. |
| Plantae | Apiaceae | Levisticum officinale  | Ref. |
| Plantae | Apocynaceae | Thevetia neriifolia | Ref. |
| Plantae | Asteraceae | Achyrocline flaccida | Ref. |
| Plantae | Asteraceae | Ambrosia deltoidea | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Balsamorhiza macrophylla | Ref. |
| Plantae | Asteraceae | Blumea balsamifera  | Ref. |
| Plantae | Asteraceae | Chromolaena odorata  | Ref. |
| Plantae | Betulaceae | Alnus glutinosa  | Ref. |
| Plantae | Capparaceae | Capparis spinosa  | Ref. |
| Plantae | Costaceae | Costus spicatus  | Ref. |
| Plantae | Cruciferae | Raphanus sativus  | Ref. |
| Plantae | Fabaceae | Ceratonia siliqua  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Malvaceae | Gossypium hirsutum  | Ref. |
| Plantae | Polygonaceae | Rumex acetosa  | Ref. |
| Plantae | Rutaceae | Zanthoxylum bungeanum  | Ref. |
| Plantae | Tamaricaceae | Tamarix spp. | Ref. |
| Plantae | Velloziaceae | Vellozia streptophylla | Ref. |
|
|
zoom in
| Organism | Achyrocline flaccida | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Gupta,J.Chem.Soc.,(1954),3063 |
|---|
|