| Name |
Flindulatin 5-Hydroxy-3,4',7,8-tetramethoxyflavone 3,7,8,4'-Tetramethylherbacetin 5-Hydroxy-3,7,8-trimethoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one |
| Formula |
C19H18O7 |
| Mw |
358.10525293 |
| CAS RN |
521-44-8 |
| C_ID |
C00004622
, 
|
| InChIKey |
SQOMVBRIXCJFKW-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H18O7/c1-22-11-7-5-10(6-8-11)16-19(25-4)15(21)14-12(20)9-13(23-2)17(24-3)18(14)26-16/h5-9,20H,1-4H3 |
| SMILES |
COc1ccc(-c2oc3c(OC)c(OC)cc(O)c3c(=O)c2OC)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Conyza stricta  | Ref. |
| Plantae | Asteraceae | Helichrysum foetidum  | Ref. |
| Plantae | Asteraceae | Ozothamnus spp. | Ref. |
| Plantae | Capparaceae | Cleome spinosa  | Ref. |
| Plantae | Cistaceae | Cistus albanicus | Ref. |
| Plantae | Nothofagaceae/Fagaceae | Nothofagus menziesii | Ref. |
| Plantae | Nothofagaceae/Fagaceae | Nothofagus nervosa | Ref. |
| Plantae | Rutaceae | Flindersia maculosa | Ref. |
|
|
zoom in
| Organism | Cistus albanicus | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Browun,Aust.J.Chem.,7,(1954),181 |
|---|
|