| Name |
3-Hydroxy-4'-methoxyflavone |
| Formula |
C16H12O4 |
| Mw |
268.07355887 |
| CAS RN |
6889-78-7 |
| C_ID |
C00004532
, 
|
| InChIKey |
IIBBFGMVMNZMGA-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O4/c1-19-11-8-6-10(7-9-11)16-15(18)14(17)12-4-2-3-5-13(12)20-16/h2-9,18H,1H3 |
| SMILES |
COc1ccc(-c2oc3ccccc3c(=O)c2O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Macroptilium spp. | Ref. |
| Plantae | Fabaceae | Millettia zechiana | Ref. |
| Plantae | Fabaceae | Phaseolus spp. | Ref. |
| Plantae | Fabaceae | Vigna luteola | Ref. |
| Plantae | Fabaceae | Vigna peduncularis | Ref. |
|
|
zoom in
| Organism | Vigna peduncularis | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Parvez, Phytochem.,29,(1990),2043 |
|---|
|