| Name |
Luteolin 3'-O-beta-D-glucuronide Luteolin-3'-O-glucuronide |
| Formula |
C21H18O12 |
| Mw |
462.07982604 |
| CAS RN |
53527-42-7 |
| C_ID |
C00004274
, 
|
| InChIKey |
JDOFZOKGCYYUER-GGNWGOABNA-N |
| InChICode |
InChI=1S/C21H18O12/c22-8-4-10(24)15-11(25)6-12(31-14(15)5-8)7-1-2-9(23)13(3-7)32-21-18(28)16(26)17(27)19(33-21)20(29)30/h1-6,16-19,21-24,26-28H,(H,29,30)/t16-,17-,18+,19-,21+/m0/s1 |
| SMILES |
O=C(O)C1O[C@@H](Oc2cc(-c3cc(=O)c4c(O)cc(O)cc4o3)ccc2O)C(O)[C@@H](O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Conocephalaceae | Conocephalum conicum | Ref. |
| Plantae | Hydrocharitaceae | Enhalus acoroides | Ref. |
| Plantae | Labiatae | Elsholtzia rugulosa Hemsl. | Ref. |
| Plantae | Labiatae | Melissa officinalis  | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Ophioglossaceae | Lunularia cruciata | Ref. |
|
|
zoom in
| Organism | Rosmarinus officinalis | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|