| Name |
Hispidulin 7-O-beta-glucoside (-)-Hispidulin 7-O-beta-glucoside Hispidulin 7-glucoside Hispidulin-7-O-beta-D-glucopyranoside Homoplantaginin |
| Formula |
C22H22O11 |
| Mw |
462.11621155 |
| CAS RN |
17680-84-1 |
| C_ID |
C00004231
, 
|
| InChIKey |
GCLAFEGUXXHIFT-JLXUOMDBNA-N |
| InChICode |
InChI=1S/C22H22O11/c1-30-21-14(32-22-20(29)19(28)17(26)15(8-23)33-22)7-13-16(18(21)27)11(25)6-12(31-13)9-2-4-10(24)5-3-9/h2-7,15,17,19-20,22-24,26-29H,8H2,1H3/t15-,17-,19+,20-,22-/m1/s1 |
| SMILES |
COc1c(O[C@@H]2OC(CO)[C@@H](O)[C@H](O)C2O)cc2oc(-c3ccc(O)cc3)cc(=O)c2c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Bignoniaceae | Fernandoa adenophylla | Ref. |
| Plantae | Eriocaulaceae | Eriocaulon buergerianum | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Plantaginaceae | Plantago asiatica  | Ref. |
| Plantae | Plantaginaceae | Plantago major  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia ningpoensis  | Ref. |
|
|
zoom in
| Organism | Plantago asiatica | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 3.Flavone O-glycosides, John Wiley & Son
Aritomi,Chem.Pharm.Bull.,12,(1964),41 |
|---|
|