| Name |
Apigenin 7-(6''-malonylglucoside) |
| Formula |
C24H22O13 |
| Mw |
518.10604079 |
| CAS RN |
86546-87-4 |
| C_ID |
C00004175
, 
|
| InChIKey |
JXWAQRJFONLTSI-UKUUIXKKNA-N |
| InChICode |
InChI=1S/C24H22O13/c25-11-3-1-10(2-4-11)15-7-14(27)20-13(26)5-12(6-16(20)36-15)35-24-23(33)22(32)21(31)17(37-24)9-34-19(30)8-18(28)29/h1-7,17,21-26,31-33H,8-9H2,(H,28,29)/t17-,21-,22+,23-,24-/m1/s1 |
| SMILES |
O=C(O)CC(=O)OCC1O[C@@H](Oc2cc(O)c3c(=O)cc(-c4ccc(O)cc4)oc3c2)C(O)[C@@H](O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Petroselinum crispum  | Ref. |
| Plantae | Asteraceae | Chamomilla recutita (L.) Rauschert | Ref. |
| Plantae | Fabaceae | Lupinus spp. | Ref. |
| Plantae | Pontederiaceae | Eichhornia crassipes | Ref. |
| - | - | Bryum capillare | Ref. |
|
|
zoom in
| Organism | Bryum capillare |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 3.Flavone O-glycosides, John Wiley & Son
Stein,Naturforsch C, 40,(1985),469 |
|---|
|
