| Name |
5,7,4'-Trihydroxy-6,3',5'-trimethoxyflavone 5,7-Dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-6-methoxy-4H-1-benzopyran-4-one 6-Methoxytricin |
| Formula |
C18H16O8 |
| Mw |
360.08451749 |
| CAS RN |
76015-42-4 |
| C_ID |
C00003944
, 
|
| InChIKey |
BVRHGBHZAQNORL-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H16O8/c1-23-13-4-8(5-14(24-2)16(13)21)11-6-9(19)15-12(26-11)7-10(20)18(25-3)17(15)22/h4-7,20-22H,1-3H3 |
| SMILES |
COc1cc(-c2cc(=O)c3c(O)c(OC)c(O)cc3o2)cc(OC)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Artemisia assoana | Ref. |
| Plantae | Asteraceae | Artemisia frigida | Ref. |
| Plantae | Asteraceae | Artemisia vestita  | Ref. |
| Plantae | Asteraceae | Carphochaete bigelovii | Ref. |
| Plantae | Asteraceae | Conoclinium coelestinum | Ref. |
| Plantae | Asteraceae | Conoclinium greggii | Ref. |
| Plantae | Asteraceae | Eupatorium capillifolium | Ref. |
| Plantae | Capparaceae | Cleome droserifolia  | Ref. |
|
|
zoom in
| Organism | Conoclinium coelestinum | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Herz,Phytochem.,19,(1980),669
Sharaf,Biochem.Syst.Ecol.,20<(1992),443 |
|---|
|