| Name |
5,7,3',4',5'-Pentamethoxyflavone Tricetin 5,7,3',4',5'-pentamethyl ether 5,7-Dimethoxy-2-(3,4,5-trimethoxyphenyl)-4H-1-benzopyran-4-one |
| Formula |
C20H20O7 |
| Mw |
372.12090299 |
| CAS RN |
53350-26-8 |
| C_ID |
C00003918
, 
|
| InChIKey |
GIKVSFNAEBQLGB-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C20H20O7/c1-22-12-8-15(23-2)19-13(21)10-14(27-16(19)9-12)11-6-17(24-3)20(26-5)18(7-11)25-4/h6-10H,1-5H3 |
| SMILES |
COc1cc(OC)c2c(=O)cc(-c3cc(OC)c(OC)c(OC)c3)oc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Bauhinia champinii | Ref. |
| Plantae | Fabaceae | Bauhinia championii  | Ref. |
| Plantae | Moraceae | Ficus maxima  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Merrillia caloxylon | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Rutaceae | Neoraputia paraensis | Ref. |
|
|
zoom in
| Organism | Merrillia caloxylon | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Tetrahedron Lett.,(1967),4579 |
|---|
|