| Name |
Tricetin 3',4',5'-trimethyl ether 5,7-Dihydroxy-3',4',5'-trimethoxyflavone 5,7-Dihydroxy-2-(3,4,5-trimethoxyphenyl)-4H-1-benzopyran-4-one |
| Formula |
C18H16O7 |
| Mw |
344.08960287 |
| CAS RN |
18103-42-9 |
| C_ID |
C00003916
, 
|
| InChIKey |
CPCPHNWWTJLXKQ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H16O7/c1-22-15-4-9(5-16(23-2)18(15)24-3)13-8-12(21)17-11(20)6-10(19)7-14(17)25-13/h4-8,19-20H,1-3H3 |
| SMILES |
COc1cc(-c2cc(=O)c3c(O)cc(O)cc3o2)cc(OC)c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Boraginaceae | Nonea pulla | Ref. |
| Plantae | Phyllanthaceae | Bridelia ferruginea  | Ref. |
| Plantae | Plantaginaceae | Asarina procumbens | Ref. |
| Plantae | Poaceae | Bromus pauciflora | Ref. |
| Plantae | Poaceae | Hordeum vulgare hexastichon  | Ref. |
|
|
zoom in
| Organism | Hordeum vulgare hexastichon | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Kaneta,Agric.Biol.Chem.,37,(1973),2663 |
|---|
|