| Name |
2'-Hydroxyflavone |
| Formula |
C15H10O3 |
| Mw |
238.06299419 |
| CAS RN |
35244-11-2 |
| C_ID |
C00003791
, 
|
| InChIKey |
ZZLQHXCRRMUGQJ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O3/c16-12-7-3-1-5-10(12)15-9-13(17)11-6-2-4-8-14(11)18-15/h1-9,16H |
| SMILES |
O=c1cc(-c2ccccc2O)oc2ccccc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Polygonaceae | Polygonum denticulata | Ref. |
| Plantae | Primulaceae | Primula farinose | Ref. |
| Plantae | Primulaceae | Primula spp. | Ref. |
| Plantae | Primulaceae | Primula veris  | Ref. |
| Plantae | Thymelaeaceae | Daphnopsis selloniana | Ref. |
|
|
zoom in
| Organism | Daphnopsis selloniana | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Bouilolan,Acad. Sci. D.,273,(1971)1629
Blasko,J. Nat. Prod.,51,(1988)61 |
|---|
|