| Name |
Torulene 3',4'-Didehydro-beta,psi-carotene |
| Formula |
C40H54 |
| Mw |
534.42255172 |
| CAS RN |
547-23-9 |
| C_ID |
C00003786
, 
|
| InChIKey |
AIBOHNYYKWYQMM-MXBSLTGDSA-N |
| InChICode |
InChI=1S/C40H54/c1-32(2)18-13-21-35(5)24-15-26-36(6)25-14-22-33(3)19-11-12-20-34(4)23-16-27-37(7)29-30-39-38(8)28-17-31-40(39,9)10/h11-16,18-27,29-30H,17,28,31H2,1-10H3/b12-11+,21-13+,22-14+,23-16+,26-15+,30-29+,33-19+,34-20+,35-24+,36-25+,37-27+ |
| SMILES |
CC(C)=C/C=C/C(C)=C/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Coccinellidae | Coccinella septempunctata | Ref. |
| Fungi | Pucciniaceae | Puccinia graminis | Ref. |
| Fungi | Sordariaceae | Neurospora crassa | Ref. |
| Fungi | Sporidiobolaceae | Rhodotorula spp. | Ref. |
| - | - | occurs in many fungi | Ref. |
|
|
zoom in
| Organism | occurs in many fungi | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|