| Name |
Testosterone |
| Formula |
C19H28O2 |
| Mw |
288.20893014 |
| CAS RN |
58-22-0 |
| C_ID |
C00003675
, 
|
| InChIKey |
MUMGGOZAMZWBJJ-ANRCXJGDNA-N |
| InChICode |
InChI=1S/C19H28O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h11,14-17,21H,3-10H2,1-2H3/t14-,15-,16-,17-,18-,19-/m0/s1 |
| SMILES |
C[C@]12CC[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@@H]2O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Pinaceae | Pinus sylvestris | Ref. |
| - | - | Botrytis cinerea | Ref. |
| - | - | Moschus moschiferus | Ref. |
|
|
zoom in
| Organism | Moschus moschiferus |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|
