| Name |
Schottenol |
| Formula |
C29H50O |
| Mw |
414.38616622 |
| CAS RN |
521-03-9 |
| C_ID |
C00003671
, 
|
| InChIKey |
YSKVBPGQYRAUQO-YLPBZDMJNA-N |
| InChICode |
InChI=1S/C29H50O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h11,19-23,25-27,30H,7-10,12-18H2,1-6H3/t20-,21-,22+,23+,25-,26+,27+,28+,29-/m1/s1 |
| SMILES |
CC[C@H](CC[C@@H](C)[C@H]1CC[C@H]2C3=CC[C@H]4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C)C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Helianthus annuus  | Ref. |
| Plantae | Cactaceae | Lophocereus schottii | Ref. |
| Plantae | Chenopodiaceae | Spinacia oleracea  | Ref. |
| Plantae | Cucurbitaceae | Cucumis sativus  | Ref. |
| - | - | Cactaceae spp. | Ref. |
|
|
zoom in
| Organism | Cactaceae spp. | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|