| Name |
Olaxoside |
| Formula |
C48H76O18 |
| Mw |
940.50316563 |
| CAS RN |
80135-33-7 |
| C_ID |
C00003536
, 
|
| InChIKey |
FWGUQBCYEUGRPQ-MFBHMTTHNA-N |
| InChICode |
InChI=1S/C48H76O18/c1-21-28(50)30(52)33(55)39(61-21)64-36-32(54)35(57)41(65-37(36)38(58)59)63-27-12-13-45(6)25(44(27,4)5)11-14-47(8)26(45)10-9-22-23-19-43(2,3)15-17-48(23,18-16-46(22,47)7)42(60)66-40-34(56)31(53)29(51)24(20-49)62-40/h9,21,23-37,39-41,49-57H,10-20H2,1-8H3,(H,58,59)/t21-,23+,24-,25+,26-,27+,28+,29-,30+,31-,32-,33+,34-,35-,36+,37+,39+,40+,41+,45+,46-,47-,48+/m1/s1 |
| SMILES |
CC1O[C@@H](O[C@@H]2C(C(=O)O)O[C@@H](O[C@H]3CC[C@]4(C)[C@H]5CC=C6[C@@H]7CC(C)(C)CC[C@]7(C(=O)O[C@@H]7OC(CO)[C@@H](O)C(O)C7O)CC[C@@]6(C)[C@]5(C)CC[C@H]4C3(C)C)C(O)[C@H]2O)C(O)[C@@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Olacaceae | Olax andronensis | Ref. |
| Plantae | Olacaceae | Olax glabriflora | Ref. |
| Plantae | Olacaceae | Olax psittacorum | Ref. |
| Plantae | Olacaceae | Olax psitticorum | Ref. |
| Plantae | Olacaceae | Olax sp. | Ref. |
| Plantae | Olacaceae | Olax spp. | Ref. |
|
|
zoom in
| Organism | Olax sp. |
|---|
| Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|
