| Name |
Xanthumin |
| Formula |
C17H22O5 |
| Mw |
306.14672381 |
| CAS RN |
26791-72-0 |
| C_ID |
C00003395
, 
|
| InChIKey |
DPSCQKGSAHTWSP-PCILPSHPNA-N |
| InChICode |
InChI=1S/C17H22O5/c1-9-7-15-14(11(3)17(20)22-15)6-5-13(9)16(8-10(2)18)21-12(4)19/h5,9,14-16H,3,6-8H2,1-2,4H3/t9-,14+,15+,16+/m0/s1 |
| SMILES |
C=C1C(=O)O[C@@H]2C[C@H](C)C([C@@H](CC(C)=O)OC(C)=O)=CC[C@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Xanthium chasei | Ref. |
| Plantae | Asteraceae | Xanthium chinense | Ref. |
| Plantae | Asteraceae | Xanthium indicum  | Ref. |
| Plantae | Asteraceae | Xanthium occidentale | Ref. |
| Plantae | Asteraceae | Xanthium sibiricum  | Ref. |
| Plantae | Asteraceae | Xanthium strumarium  | Ref. |
| - | - | Zanthium chasei | Ref. |
|
|
zoom in
| Organism | Xanthium sibiricum | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|