| Name |
Salonitenolide |
| Formula |
C15H20O4 |
| Mw |
264.13615913 |
| CAS RN |
26931-94-2 |
| C_ID |
C00003362
, 
|
| InChIKey |
BLDTUWFMPJJRPR-PTKMZVDXNA-N |
| InChICode |
InChI=1S/C15H20O4/c1-9-4-3-5-11(8-16)7-13-14(12(17)6-9)10(2)15(18)19-13/h4,7,12-14,16-17H,2-3,5-6,8H2,1H3/b9-4+,11-7-/t12-,13-,14+/m0/s1 |
| SMILES |
C=C1C(=O)O[C@@H]2/C=C(CO)CC/C=C(C)C[C@H](O)[C@@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Berkheya speciosa | Ref. |
| Plantae | Asteraceae | Centaurea salonitana | Ref. |
| Plantae | Asteraceae | Cnicus benedictus  | Ref. |
| Plantae | Asteraceae | Jurinea maxima | Ref. |
| - | - | family Asteraceae spp. | Ref. |
|
|
zoom in
| Organism | family Asteraceae spp. | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|