| Name |
Ledol
(+)-Ledol |
| Formula |
C15H26O |
| Mw |
222.19836545 |
| CAS RN |
577-27-5 |
| C_ID |
C00003161
, 
|
| InChIKey |
AYXPYQRXGNDJFU-MIBAWIEXNA-N |
| InChICode |
InChI=1S/C15H26O/c1-9-5-6-10-12(9)13-11(14(13,2)3)7-8-15(10,4)16/h9-13,16H,5-8H2,1-4H3/t9-,10+,11-,12-,13+,15-/m1/s1 |
| SMILES |
C[C@@H]1CC[C@H]2[C@@H]1[C@H]1[C@@H](CC[C@@]2(C)O)C1(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Strobilanthes crispus  | Ref. |
| Plantae | Annonaceae | Xylopia sericea | Ref. |
| Plantae | Apiaceae | Bupleurum scorzonerifolium | Ref. |
| Plantae | Araliaceae | Panax ginseng | Ref. |
| Plantae | Aristolochiaceae | Aristolochia indica | Ref. |
| Plantae | Asteraceae | Anthemis aciphylla BOISS.var.discoidea BOISS | Ref. |
| Plantae | Asteraceae | Matricaria recutita | Ref. |
| Plantae | Asteraceae | Tanacetum macrophyllum | Ref. |
| Plantae | Cannabaceae | Humulus lupulus | Ref. |
| Plantae | Cistaceae | Cistus creticus | Ref. |
| Plantae | Ericaceae | Ledum columbianum | Ref. |
| Plantae | Ericaceae | Ledum groenlandicum | Ref. |
| Plantae | Ericaceae | Ledum palustre | Ref. |
| Plantae | Fabaceae | Rhynchosia minima | Ref. |
| Plantae | Jubulaceae | Frullania tamarisci | Ref. |
| Plantae | Meliaceae | Azadirachta indica | Ref. |
| Plantae | Meliaceae | Entandrophragma candolei | Ref. |
| Plantae | Meliaceae | Entandrophragma cyclindricum | Ref. |
| Plantae | Meliaceae | Entandrophragma utile | Ref. |
| Plantae | Meliaceae | Guarea macrophylla ssp.tuberculata | Ref. |
| Plantae | Myrtaceae | Melaleuca leucadendra L. | Ref. |
| Plantae | Myrtaceae | Melaleuca leucadendron | Ref. |
| Plantae | Myrtaceae | Psidium guajava | Ref. |
| Plantae | Piperaceae | Piper nigrum | Ref. |
| Plantae | Piperaceae | Piper spp. | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana jatamansi | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis | Ref. |
| Plantae | Zingiberaceae | Curcuma amada | Ref. |
| Plantae | Zingiberaceae | Curcuma amanda Roxb | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale | Ref. |
| - | - | Lepicolea ochroleuca | Ref. |
|
|
zoom in
| Organism | Aristolochia indica |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11 |
|---|
|
