| Name |
Elemicin |
| Formula |
C12H16O3 |
| Mw |
208.10994438 |
| CAS RN |
487-11-6 |
| C_ID |
C00002739
, 
|
| InChIKey |
BPLQKQKXWHCZSS-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C12H16O3/c1-5-6-9-7-10(13-2)12(15-4)11(8-9)14-3/h5,7-8H,1,6H2,2-4H3 |
| SMILES |
C=CCc1cc(OC)c(OC)c(OC)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acoraceae | Acorus calamus  | Ref. |
| Plantae | Annonaceae | Uvariodendron connivens | Ref. |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Apiaceae | Ligusticum jeholense | Ref. |
| Plantae | Apiaceae | Petroselinum crispum  | Ref. |
| Plantae | Asteraceae | Petasites albus  | Ref. |
| Plantae | Burseraceae | Canarium commune  | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus officinalis  | Ref. |
| Plantae | Euphorbiaceae | Croton nepetaefolius | Ref. |
| Plantae | Fabaceae | Dalbergia spruceana | Ref. |
| Plantae | Fabaceae | Monopteryx uaucu | Ref. |
| Plantae | Fabaceae | Tipuana tipu | Ref. |
| Plantae | Labiatae | Perilla frutescens  | Ref. |
| Plantae | Lauraceae | Aniba spp. | Ref. |
| Plantae | Lauraceae | Cinnamomum glanduliferum  | Ref. |
| Plantae | Linderniaceae | Micranthemum umbrosum | Ref. |
| Plantae | Myristicaceae | Myristica fragrans  | Ref. |
| Plantae | Myrtaceae | Backhousia myrtifolia | Ref. |
| Plantae | Myrtaceae | Melaleuca bracteata | Ref. |
| Plantae | Phyllanthaceae | Bridelia retusa  | Ref. |
| Plantae | Piperaceae | Piper brachystachyum | Ref. |
| Plantae | Piperaceae | Piper solmsianum | Ref. |
| Plantae | Poaceae | Cymbopogon procerus | Ref. |
| Plantae | Rutaceae | Atalantia guillauminii | Ref. |
| Plantae | Rutaceae | Boronia pinnata | Ref. |
| Plantae | Rutaceae | Ruta graveolens  | Ref. |
| Plantae | Rutaceae | Zieria smithii | Ref. |
| Plantae | Saururaceae | Anemopsis californica | Ref. |
| - | - | Heterotropha curvistigma | Ref. |
| - | - | Heterotropha hexaloba | Ref. |
| - | - | Heterotropha nipponca | Ref. |
|
|
zoom in
| Organism | Petroselinum crispum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|