| Name |
Resorcinol |
| Formula |
C6H6O2 |
| Mw |
110.03677944 |
| CAS RN |
108-46-3 |
| C_ID |
C00002671
, 
|
| InChIKey |
GHMLBKRAJCXXBS-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C6H6O2/c7-5-2-1-3-6(8)4-5/h1-4,7-8H |
| SMILES |
Oc1cccc(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Anacardium occidentale  | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Fabaceae | Lupinus albus  | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Labiatae | Thymus capitatus  | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Myrtaceae | Eugenia jambolana  | Ref. |
| Plantae | Pinaceae | Pinus rigida | Ref. |
| Plantae | Pinaceae | Pinus sibirica | Ref. |
|
|
zoom in
| Organism | Thymus capitatus | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|