| Name |
Vestitone 7,2'-Dihydroxy-4'-methoxyisoflavanone Vistitone |
| Formula |
C16H14O5 |
| Mw |
286.08412356 |
| CAS RN |
66211-83-4 |
| C_ID |
C00002584
, 
|
| InChIKey |
WQCJOKYOIJVEFN-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C16H14O5/c1-20-10-3-5-11(14(18)7-10)13-8-21-15-6-9(17)2-4-12(15)16(13)19/h2-7,13,17-18H,8H2,1H3/t13-/m1/s1 |
| SMILES |
COc1ccc(C2COc3cc(O)ccc3C2=O)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Dalbergia odorifera  | Ref. |
| Plantae | Fabaceae | Medicago rugosa | Ref. |
| Plantae | Fabaceae | Medicago truncatula | Ref. |
| Plantae | Fabaceae | Melilotus messanensis | Ref. |
| Plantae | Fabaceae | Onobrychis vicifolia | Ref. |
| Plantae | Fabaceae | Onobrychis viciifolia  | Ref. |
| Plantae | Fabaceae | Tipuana tipu | Ref. |
| Plantae | Fabaceae | Trifolium repens  | Ref. |
|
|
zoom in
| Organism | Onobrychis vicifolia | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|