| Name |
Spathelia bischromene |
| Formula |
C20H20O4 |
| Mw |
324.13615913 |
| CAS RN |
34411-93-3 |
| C_ID |
C00002446
, 
|
| InChIKey |
CUFLINMPEWUGEH-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C20H20O4/c1-11-10-14(21)15-17(22-11)12-6-8-19(2,3)23-16(12)13-7-9-20(4,5)24-18(13)15/h6-10H,1-5H3 |
| SMILES |
Cc1cc(=O)c2c3c(c4c(c2o1)C=CC(C)(C)O4)C=CC(C)(C)O3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rutaceae | Cneorum pulverulentum | Ref. |
| Plantae | Rutaceae | Cneorum tricoccum | Ref. |
| Plantae | Rutaceae | Spathelia glabrescens | Ref. |
| Plantae | Rutaceae | Spathelia sorbifolia | Ref. |
| - | - | family Rutaceae spp. | Ref. |
|
|
zoom in
| Organism | family Rutaceae spp. | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|