| Name |
Rubrofusarin |
| Formula |
C15H12O5 |
| Mw |
272.06847349 |
| CAS RN |
3567-00-8 |
| C_ID |
C00002445
, 
|
| InChIKey |
FPNKCZKRICBAKG-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H12O5/c1-7-3-10(16)14-12(20-7)5-8-4-9(19-2)6-11(17)13(8)15(14)18/h3-6,17-18H,1-2H3 |
| SMILES |
COc1cc(O)c2c(O)c3c(=O)cc(C)oc3cc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Nectriaceae | Fusarium culmorum | Ref. |
| Fungi | Nectriaceae | Fusarium graminearum | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Fabaceae | Cassia quinquangula | Ref. |
| Plantae | Fabaceae | Cassia tora  | Ref. |
| Plantae | Fabaceae | Senna obliqua | Ref. |
| Plantae | Fabaceae | Senna quinquangulata  | Ref. |
| Plantae | Fabaceae | Senna tora  | Ref. |
|
|
zoom in
| Organism | Cassia tora | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|