| Name |
Toxyl angelate |
| Formula |
C18H20O4 |
| Mw |
300.13615913 |
| CAS RN |
106928-36-3 |
| C_ID |
C00002411
, 
|
| InChIKey |
LQUPQVIPBLTZNW-NFYHKHNENA-N |
| InChICode |
InChI=1S/C18H20O4/c1-6-11(4)18(20)22-17-14-9-13(12(5)19)7-8-15(14)21-16(17)10(2)3/h6-9,16-17H,2H2,1,3-5H3/b11-6-/t16-,17+/m0/s1 |
| SMILES |
C=C(C)[C@@H]1Oc2ccc(C(C)=O)cc2[C@H]1OC(=O)/C(C)=CC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Bahianthus viscidus | Ref. |
| Plantae | Asteraceae | Haplopappus heterophyllus | Ref. |
| Plantae | Asteraceae | Haplopappus tenuisectus | Ref. |
| Plantae | Asteraceae | Morithamnus crassus | Ref. |
| - | - | family Asteraceae spp. | Ref. |
|
|
zoom in
| Organism | family Asteraceae spp. | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|