| Name |
Tylophorine |
| Formula |
C24H27NO4 |
| Mw |
393.19400836 |
| CAS RN |
482-20-2 |
| C_ID |
C00002367
, 
|
| InChIKey |
SSEUDFYBEOIWGF-YQTOOIBONA-N |
| InChICode |
InChI=1S/C24H27NO4/c1-26-21-9-16-15-8-14-6-5-7-25(14)13-20(15)19-12-24(29-4)23(28-3)11-18(19)17(16)10-22(21)27-2/h9-12,14H,5-8,13H2,1-4H3/t14-/m0/s1 |
| SMILES |
COc1cc2c3c(c4cc(OC)c(OC)cc4c2cc1OC)CN1CCC[C@H]1C3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro L-Lys |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Cynanchum vincetoxicum | Ref. |
| Plantae | Apocynaceae | Pergularia pallida | Ref. |
| Plantae | Apocynaceae | Tylophora asthmatica  | Ref. |
| Plantae | Apocynaceae | Tylophora crebriflora | Ref. |
| Plantae | Apocynaceae | Tylophora floribunda | Ref. |
| Plantae | Apocynaceae | Tylophora tanakae | Ref. |
| Plantae | Apocynaceae | Vincetoxicum hirundinara | Ref. |
| Plantae | Apocynaceae | Vincetoxicum officinale | Ref. |
| Plantae | Moraceae | Ficus septica | Ref. |
|
|
zoom in
| Organism | Tylophora floribunda | | Reference | Ji, et al., Pharmacological Action and Application of Available Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1995).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|