| Name |
alpha-Solamargine Solamargine |
| Formula |
C45H73NO15 |
| Mw |
867.49802067 |
| CAS RN |
20311-51-7 |
| C_ID |
C00002260
, 
|
| InChIKey |
MBWUSSKCCUMJHO-KGDIGVFGNA-N |
| InChICode |
InChI=1S/C45H73NO15/c1-19-9-14-45(46-17-19)20(2)30-28(61-45)16-27-25-8-7-23-15-24(10-12-43(23,5)26(25)11-13-44(27,30)6)57-42-39(60-41-36(53)34(51)32(49)22(4)56-41)37(54)38(29(18-47)58-42)59-40-35(52)33(50)31(48)21(3)55-40/h7,19-22,24-42,46-54H,8-18H2,1-6H3/t19-,20+,21+,22-,24+,25-,26+,27+,28+,29+,30+,31+,32+,33-,34-,35-,36-,37+,38+,39-,40+,41+,42+,43+,44+,45-/m1/s1 |
| SMILES |
CC1O[C@@H](OC2[C@H](O[C@H]3CC[C@@]4(C)C(=CC[C@H]5[C@@H]6C[C@@H]7O[C@]8(CC[C@@H](C)CN8)[C@@H](C)[C@@H]7[C@@]6(C)CC[C@@H]54)C3)OC(CO)[C@@H](O[C@@H]3OC(C)[C@H](O)[C@H](O)C3O)[C@@H]2O)C(O)[C@@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Solanaceae | Solanum aculeastrum Dunal  | Ref. |
| Plantae | Solanaceae | Solanum americanum  | Ref. |
| Plantae | Solanaceae | Solanum chenopodioides | Ref. |
| Plantae | Solanaceae | Solanum dulcamara  | Ref. |
| Plantae | Solanaceae | Solanum frutescens | Ref. |
| Plantae | Solanaceae | Solanum khasianum | Ref. |
| Plantae | Solanaceae | Solanum kieseritzkii | Ref. |
| Plantae | Solanaceae | Solanum lycocarpum | Ref. |
| Plantae | Solanaceae | Solanum lyratum  | Ref. |
| Plantae | Solanaceae | Solanum marginatum  | Ref. |
| Plantae | Solanaceae | Solanum melongena  | Ref. |
| Plantae | Solanaceae | Solanum nigrum L.  | Ref. |
| Plantae | Solanaceae | Solanum oleraceum  | Ref. |
| Plantae | Solanaceae | Solanum plantanifolium | Ref. |
| Plantae | Solanaceae | Solanum robustum Wendl. | Ref. |
| Plantae | Solanaceae | Solanum rostratum Dun.  | Ref. |
| Plantae | Solanaceae | Solanum scabrum | Ref. |
| Plantae | Solanaceae | Solanum sodomaeum | Ref. |
| Plantae | Solanaceae | Solanum sycophanta Dunal et DC | Ref. |
| Plantae | Solanaceae | Solanum transcaucasicum | Ref. |
| Plantae | Solanaceae | Solanum uporo Dun.  | Ref. |
| Plantae | Solanaceae | Solanum villosum  | Ref. |
|
|
zoom in
| Organism | Solanum frutescens | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
|---|
|