| Name |
Riddelline |
| Formula |
C18H23NO6 |
| Mw |
349.15253747 |
| CAS RN |
23246-96-0 |
| C_ID |
C00002110
, 
|
| InChIKey |
SVCNNZDUGWLODJ-OOYLDINYNA-N |
| InChICode |
InChI=1S/C18H23NO6/c1-3-12-8-11(2)18(23,10-20)17(22)24-9-13-4-6-19-7-5-14(15(13)19)25-16(12)21/h3-4,14-15,20,23H,2,5-10H2,1H3/b12-3-/t14-,15-,18-/m1/s1 |
| SMILES |
C=C1C/C(=C/C)C(=O)O[C@@H]2CCN3CC=C(COC(=O)[C@@]1(O)CO)[C@H]23 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Lys L-Arg |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Senecio aegypticus | Ref. |
| Plantae | Asteraceae | Senecio ambrosioides | Ref. |
| Plantae | Asteraceae | Senecio eremophilus | Ref. |
| Plantae | Asteraceae | Senecio longibolus | Ref. |
| Plantae | Asteraceae | Senecio riddelii | Ref. |
| Plantae | Asteraceae | Senecio riddellii | Ref. |
| Plantae | Asteraceae | Senecio vulgaris  | Ref. |
| Plantae | Fabaceae | Crotalaria juncea  | Ref. |
|
|
zoom in
| Organism | Senecio riddelii | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|