| Name |
Hygrine (+)-Hygrine D-(+)-Hygrine |
| Formula |
C8H15NO |
| Mw |
141.11536411 |
| CAS RN |
496-49-1 |
| C_ID |
C00002046
, 
|
| InChIKey |
ADKXZIOQKHHDNQ-SVGMAFHSNA-N |
| InChICode |
InChI=1S/C8H15NO/c1-7(10)6-8-4-3-5-9(8)2/h8H,3-6H2,1-2H3/t8-/m0/s1 |
| SMILES |
CC(=O)C[C@@H]1CCCN1C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Convolvulaceae | Argyreia mollis | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum coca  | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum novogranatense | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Orchidaceae | Dendrobium chrysanthum | Ref. |
| Plantae | Solanaceae | Atropa baetica | Ref. |
| Plantae | Solanaceae | Hyoscyamus albus  | Ref. |
| Plantae | Solanaceae | Hyoscyamus boveanus | Ref. |
| Plantae | Solanaceae | Hyoscyamus desertorum | Ref. |
| Plantae | Solanaceae | Hyoscyamus muticus  | Ref. |
| Plantae | Solanaceae | Nicandra physaloides | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Solanaceae | Physalis alkekengi L.  | Ref. |
| Plantae | Solanaceae | Physalis peruviana  | Ref. |
| - | - | Corallia brachiata | Ref. |
| - | - | Erythroxylon coca  | Ref. |
|
|
zoom in
| Organism | Dendrobium chrysanthum | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|