| Name |
Psychotrine |
| Formula |
C28H36N2O4 |
| Mw |
464.26750765 |
| CAS RN |
7633-29-6 |
| C_ID |
C00001907
, 
|
| InChIKey |
NCALAYAMQHIWMN-RVRIBZLXNA-N |
| InChICode |
InChI=1S/C28H36N2O4/c1-5-17-16-30-9-7-19-13-27(33-3)28(34-4)15-22(19)24(30)11-20(17)10-23-21-14-26(32-2)25(31)12-18(21)6-8-29-23/h12-15,17,20,24,31H,5-11,16H2,1-4H3/t17-,20-,24-/m0/s1 |
| SMILES |
CC[C@H]1CN2CCc3cc(OC)c(OC)cc3[C@@H]2C[C@@H]1CC1=NCCc2cc(O)c(OC)cc21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr Secologanin |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Alangium lamarckii | Ref. |
| Plantae | Rubiaceae | Cephaelis acuminata | Ref. |
| Plantae | Rubiaceae | Cephaelis ipecacuanha  | Ref. |
| Plantae | Rubiaceae | Pogonopus speciosus | Ref. |
| - | - | Allangium lamarckii | Ref. |
|
|
zoom in
| Organism | Allangium lamarckii | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|