| Name |
Sinigrin 2-Phenylethyl glucosinolate Allyl glucosinolate |
| Formula |
C10H17NO9S2 |
| Mw |
359.03447261 |
| CAS RN |
3952-98-5 |
| C_ID |
C00001488
, 
|
| InChIKey |
PHZOWSSBXJXFOR-VNZKQILNNA-N |
| InChICode |
InChI=1S/C10H17NO9S2/c1-2-3-6(11-20-22(16,17)18)21-10-9(15)8(14)7(13)5(4-12)19-10/h2,5,7-10,12-15H,1,3-4H2,(H,16,17,18)/b11-6+/t5-,7-,8-,9+,10+/m0/s1 |
| SMILES |
C=CC/C(=N/OS(=O)(=O)O)S[C@H]1OC(CO)[C@H](O)C(O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Arg L-Ala |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Brassicaceae | Hirschfeldia incana  | Ref. |
| Plantae | Brassicaceae | Wasabi japonica | Ref. |
| Plantae | Capparaceae | Capparis ovata  | Ref. |
| Plantae | Capparaceae | Capparis spinosa  | Ref. |
| Plantae | Caprifoliaceae | Patrinia sp. | Ref. |
| Plantae | Cruciferae | Alliaria petiolata  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Arabis kennedyae | Ref. |
| Plantae | Cruciferae | Arabis laevigata | Ref. |
| Plantae | Cruciferae | Arabis petiolaris | Ref. |
| Plantae | Cruciferae | Armoracia lapathifolia  | Ref. |
| Plantae | Cruciferae | Barbarea intermedia | Ref. |
| Plantae | Cruciferae | Barbarea stricta | Ref. |
| Plantae | Cruciferae | Barbarea vulgaris  | Ref. |
| Plantae | Cruciferae | Brassica hirta  | Ref. |
| Plantae | Cruciferae | Brassica juncea  | Ref. |
| Plantae | Cruciferae | Brassica nigra  | Ref. |
| Plantae | Cruciferae | Brassica oleracea  | Ref. |
| Plantae | Cruciferae | Brassica oleraceae | Ref. |
| Plantae | Cruciferae | Brassica oleracea var. capitata  | Ref. |
| Plantae | Cruciferae | Brassica rapa  | Ref. |
| Plantae | Cruciferae | Brassica sprouts | Ref. |
| Plantae | Cruciferae | Cakile arabica | Ref. |
| Plantae | Cruciferae | Cakile artica | Ref. |
| Plantae | Cruciferae | Cakile constricta | Ref. |
| Plantae | Cruciferae | Cakile edentula | Ref. |
| Plantae | Cruciferae | Cakile geniculata | Ref. |
| Plantae | Cruciferae | Cakile lanceolata | Ref. |
| Plantae | Cruciferae | Cakile maritima  | Ref. |
| Plantae | Cruciferae | Capsella bursa-pastoris  | Ref. |
| Plantae | Cruciferae | Chorispora tenella | Ref. |
| Plantae | Cruciferae | Coincya longirostra | Ref. |
| Plantae | Cruciferae | Conringia planisiliqua | Ref. |
| Plantae | Cruciferae | Crambe maritima  | Ref. |
| Plantae | Cruciferae | Crucihimalaya wallichii | Ref. |
| Plantae | Cruciferae | Descurainia appendiculata | Ref. |
| Plantae | Cruciferae | Descurainia pinnata | Ref. |
| Plantae | Cruciferae | Descurainia richardsonii | Ref. |
| Plantae | Cruciferae | Descurainia sophia  | Ref. |
| Plantae | Cruciferae | Diplotaxis erucoides  | Ref. |
| Plantae | Cruciferae | Diplotaxis muralis | Ref. |
| Plantae | Cruciferae | Diplotaxis viminea | Ref. |
| Plantae | Cruciferae | Dithyrea californica | Ref. |
| Plantae | Cruciferae | Dithyrea wislizenii | Ref. |
| Plantae | Cruciferae | Draba nemorosa | Ref. |
| Plantae | Cruciferae | Erucastrum gallicum | Ref. |
| Plantae | Cruciferae | Erucastrum laevigatum | Ref. |
| Plantae | Cruciferae | Erysimum asperum | Ref. |
| Plantae | Cruciferae | Erysimum capitatum | Ref. |
| Plantae | Cruciferae | Erysimum hieracifolium | Ref. |
| Plantae | Cruciferae | Erysimum odoratum | Ref. |
| Plantae | Cruciferae | Farsetia aegyptia | Ref. |
| Plantae | Cruciferae | Farsetia clypeata | Ref. |
| Plantae | Cruciferae | Iberis umbellata | Ref. |
| Plantae | Cruciferae | Isatis indigotica  | Ref. |
| Plantae | Cruciferae | Lepidium draba  | Ref. |
| Plantae | Cruciferae | Lepidium sativum  | Ref. |
| Plantae | Cruciferae | Lesquerella ludoviciana | Ref. |
| Plantae | Cruciferae | Moricandia arvensis  | Ref. |
| Plantae | Cruciferae | Nasturtium officinale  | Ref. |
| Plantae | Cruciferae | Peltaria alliaceae | Ref. |
| Plantae | Cruciferae | Pringlea antiscorbutica | Ref. |
| Plantae | Cruciferae | Raphanus raphanistrum  | Ref. |
| Plantae | Cruciferae | Raphanus sativus  | Ref. |
| Plantae | Cruciferae | Rorippa hilariana | Ref. |
| Plantae | Cruciferae | Schouwia purpurea | Ref. |
| Plantae | Cruciferae | Sinapis arvensis  | Ref. |
| Plantae | Cruciferae | Sisymbrium alliaria | Ref. |
| Plantae | Cruciferae | Sisymbrium loesilii | Ref. |
| Plantae | Cruciferae | Sisymbrium officinale  | Ref. |
| Plantae | Cruciferae | Sisymbrium sophia | Ref. |
| Plantae | Cruciferae | Thelypodium ambiguum | Ref. |
| Plantae | Cruciferae | Thelypodium brachycarpum | Ref. |
| Plantae | Cruciferae | Thelypodium crispum | Ref. |
| Plantae | Cruciferae | Thelypodium eucosmum | Ref. |
| Plantae | Cruciferae | Thelypodium laciniatum | Ref. |
| Plantae | Cruciferae | Thelypodium laxiflorum | Ref. |
| Plantae | Cruciferae | Thelypodium paniculatum | Ref. |
| Plantae | Cruciferae | Thelypodium rollinsii | Ref. |
| Plantae | Cruciferae | Thlaspi arvense  | Ref. |
| Plantae | Cruciferae | Turritis glabra | Ref. |
|
|
zoom in
| Organism | Patrinia sp. | | Reference | Ji, et al., Pharmacological Action and Application of Available Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1995).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|