| Name |
Tiglic acid |
| Formula |
C5H8O2 |
| Mw |
100.0524295 |
| CAS RN |
80-59-1 |
| C_ID |
C00001207
, 
|
| InChIKey |
UIERETOOQGIECD-ONEGZZNKSA-N |
| InChICode |
InChI=1S/C5H8O2/c1-3-4(2)5(6)7/h3H,1-2H3,(H,6,7)/b4-3+ |
| SMILES |
C/C=C(C)C(=O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Angelica archangelica  | Ref. |
| Plantae | Apiaceae | Angelica pubescens f.biserrata  | Ref. |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Asteraceae | Anthemis nobilis  | Ref. |
| Plantae | Boraginaceae | Arnebia hispidissima | Ref. |
| Plantae | Convolvulaceae | Cuscuta chinensis  | Ref. |
| Plantae | Euphorbiaceae | Croton tiglium  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| - | - | Flavouring ingredient | Ref. |
|
|
zoom in
| Organism | Arnebia hispidissima | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|