| Name |
Dulcitol |
| Formula |
C6H14O6 |
| Mw |
182.07903818 |
| CAS RN |
608-66-2 |
| C_ID |
C00001160
, 
|
| InChIKey |
FBPFZTCFMRRESA-GUCUJZIJNA-N |
| InChICode |
InChI=1S/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4+,5+,6- |
| SMILES |
OC[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)CO |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Bacteria | Enterobacteriaceae | Escherichia coli | Ref. |
| Plantae | Celastraceae | Euonymus atropurpureus  | Ref. |
| Plantae | Celastraceae | Gymnosporia deflexa | Ref. |
| Plantae | Orobanchaceae | Melampyrum nemorosum | Ref. |
| Plantae | Plantaginaceae | Veronica hederifolia | Ref. |
| Plantae | Plantaginaceae | Veronica persica | Ref. |
|
|
zoom in
| Organism | Veronica hederifolia |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
