| Name |
8-methylherbacetin Sexangularetin |
| Formula |
C16H12O7 |
| Mw |
316.05830274 |
| CAS RN |
571-74-4 |
| C_ID |
C00001100
, 
|
| InChIKey |
AZFYHRHUTXBGJS-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O7/c1-22-15-10(19)6-9(18)11-12(20)13(21)14(23-16(11)15)7-2-4-8(17)5-3-7/h2-6,17-19,21H,1H3 |
| SMILES |
COc1c(O)cc(O)c2c(=O)c(O)c(-c3ccc(O)cc3)oc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Enceliopsis nudicaulis | Ref. |
| Plantae | Asteraceae | Eupatorium gracile | Ref. |
| Plantae | Asteraceae | Ozothamnus spp. | Ref. |
| Plantae | Crassulaceae | Rhodiola crenulata | Ref. |
| Plantae | Crassulaceae | Sedum sexangulare | Ref. |
| Plantae | Fabaceae | Dorycnium pentaphyllum | Ref. |
| Plantae | Fabaceae | Lotus corniculatus  | Ref. |
|
|
zoom in
| Organism | Sedum sexangulare | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Combier,C. R. Acad. Sci. Ser.D,266,(1968),2495 |
|---|
|