| Name |
Norwogonin |
| Formula |
C15H10O5 |
| Mw |
270.05282343 |
| CAS RN |
4443-09-8 |
| C_ID |
C00001077
, 
|
| InChIKey |
ZFKKRRMUPBBYRS-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O5/c16-9-6-11(18)14(19)15-13(9)10(17)7-12(20-15)8-4-2-1-3-5-8/h1-7,16,18-19H |
| SMILES |
O=c1cc(-c2ccccc2)oc2c(O)c(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Scutellaria amoena | Ref. |
| Plantae | Labiatae | Scutellaria baicalensis  | Ref. |
| Plantae | Labiatae | Scutellaria discolor  | Ref. |
| Plantae | Labiatae | Scutellaria epilobifolia | Ref. |
| Plantae | Labiatae | Scutellaria spp. | Ref. |
| Plantae | Labiatae | Scutellaria strigillosa | Ref. |
|
|
zoom in
| Organism | Scutellaria spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Harborne,Comparative Biochemistry of the Flavonoids,(1967)218,Academic Press
Tomimori,Chem.Pharm.Bull.,33,(1985)4457 |
|---|
|