| Name |
Isosakuranetin 5,7-Dihydroxy-4'-methoxyflavanone |
| Formula |
C16H14O5 |
| Mw |
286.08412356 |
| CAS RN |
480-43-3 |
| C_ID |
C00000973
, 
|
| InChIKey |
HMUJXQRRKBLVOO-YQTOOIBONA-N |
| InChICode |
InChI=1S/C16H14O5/c1-20-11-4-2-9(3-5-11)14-8-13(19)16-12(18)6-10(17)7-15(16)21-14/h2-7,14,17-18H,8H2,1H3/t14-/m0/s1 |
| SMILES |
COc1ccc([C@@H]2CC(=O)c3c(O)cc(O)cc3O2)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Artemisia campestris  | Ref. |
| Plantae | Asteraceae | Eupatorium odoratum  | Ref. |
| Plantae | Asteraceae | Wyethia spp. | Ref. |
| Plantae | Combretaceae | Terminalia fagifolia | Ref. |
| Plantae | Labiatae | Clinopodium chinense | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
| Plantae | Labiatae | Salvia nicolsoniana | Ref. |
| Plantae | Piperaceae | Piper crassinervium | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rosaceae | Prunus spp.  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Citrus unshiu  | Ref. |
|
|
zoom in
| Organism | Clinopodium chinense | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Park, et al., Planta Med, 71, (2005), 24 |
|---|
|