| Name |
Homoeriodictyol Homoeridictyol |
| Formula |
C16H14O6 |
| Mw |
302.07903818 |
| CAS RN |
446-71-9 |
| C_ID |
C00000969
, 
|
| InChIKey |
FTODBIPDTXRIGS-UGPWUYPHNA-N |
| InChICode |
InChI=1S/C16H14O6/c1-21-14-4-8(2-3-10(14)18)13-7-12(20)16-11(19)5-9(17)6-15(16)22-13/h2-6,13,17-19H,7H2,1H3/t13-/m0/s1 |
| SMILES |
COc1cc([C@@H]2CC(=O)c3c(O)cc(O)cc3O2)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Artemisia campestris  | Ref. |
| Plantae | Asteraceae | Chrysothamnus viscidiflorus | Ref. |
| Plantae | Asteraceae | Tanacetum sibiricum | Ref. |
| Plantae | Fabaceae | Dalbergia odorifera  | Ref. |
| Plantae | Fabaceae | Lespedeza spp. | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Hydrophyllaceae | Eriodictyon spp. | Ref. |
| Plantae | Orchidaceae | Dendrobium densiflorum Lindl.ex.Wall. | Ref. |
| Plantae | Santalaceae | Viscum coloratum  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
|
|
zoom in
| Organism | Lespedeza spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 405,Flavanones and dihydroflavonols
Ohira,J.Agr.Chem.Soc.Japan,9,(1933),448
Terasa,J.Nat.Prod.,49,(1986),177 |
|---|
|