| Name |
Abyssinone V |
| Formula |
C25H28O5 |
| Mw |
408.193674 |
| CAS RN |
77263-11-7 |
| C_ID |
C00000936
, 
|
| InChIKey |
LQHKFMYWTKORCE-ANBDAQEENA-N |
| InChICode |
InChI=1S/C25H28O5/c1-14(2)5-7-16-9-18(10-17(25(16)29)8-6-15(3)4)22-13-21(28)24-20(27)11-19(26)12-23(24)30-22/h5-6,9-12,22,26-27,29H,7-8,13H2,1-4H3/t22-/m0/s1 |
| SMILES |
CC(C)=CCc1cc([C@@H]2CC(=O)c3c(O)cc(O)cc3O2)cc(CC=C(C)C)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Erythrina abyssinica  | Ref. |
| Plantae | Fabaceae | Erythrina addisoniae | Ref. |
| Plantae | Fabaceae | Erythrina latissima | Ref. |
| Plantae | Fabaceae | Erythrina sacleuxii | Ref. |
| Plantae | Fabaceae | Erythrina sigmoidea | Ref. |
|
|
zoom in
| Organism | Erythrina sigmoidea |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 578,Flavanones and dihydroflavonols
Kamat,Heterocycles,15,(1981),1163 |
|---|
|
